Glafenine: Difference between revisions
Jump to navigation
Jump to search
Gerald Chi (talk | contribs) mNo edit summary |
Gerald Chi (talk | contribs) mNo edit summary |
||
(5 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
{{Drugbox | |||
{{ | | drug_name = Glafenine | ||
| IUPAC_name = 2,3-Dihydroxypropyl 2-[(7-chloro-4-quinolinyl)amino]benzoate | |||
| image = Glafenine.png | |||
| width = 180 | |||
| caption = | |||
<!-- Clinical data --> | |||
| tradename = | |||
| Drugs.com = | |||
| MedlinePlus = | |||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | |||
| pregnancy_US = <!-- A / B / C / D / X --> | |||
| pregnancy_category= | |||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | |||
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII --> | |||
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM --> | |||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | |||
| legal_status = | |||
| routes_of_administration = | |||
<!-- Pharmacokinetic data --> | |||
| bioavailability = | |||
| protein_bound = | |||
| metabolism = | |||
| elimination_half-life = | |||
| excretion = | |||
<!-- Identifiers --> | |||
| CAS_number = 3820-67-5 | |||
| ATCvet = | |||
| ATC_prefix = N02 | |||
| ATC_suffix = BG03 | |||
| PubChem = 3474 | |||
| ChEBI_Ref = {{ebicite|correct|EBI}} | |||
| ChEBI = 31653 | |||
| DrugBank = | |||
| ChemSpiderID = 3355 | |||
{{ | <!-- Chemical data --> | ||
| C=19 | H=17 | Cl=1 | N=2 | O=4 | |||
| molecular_weight = 372.802 g/mol | |||
| smiles = O=C(OCC(O)CO)c1ccccc1Nc2c3ccc(Cl)cc3ncc2 | |||
| InChI = 1/C19H17ClN2O4/c20-12-5-6-14-17(7-8-21-18(14)9-12)22-16-4-2-1-3-15(16)19(25)26-11-13(24)10-23/h1-9,13,23-24H,10-11H2,(H,21,22) | |||
| InChIKey = GWOFUCIGLDBNKM-UHFFFAOYAI | |||
| StdInChI = 1S/C19H17ClN2O4/c20-12-5-6-14-17(7-8-21-18(14)9-12)22-16-4-2-1-3-15(16)19(25)26-11-13(24)10-23/h1-9,13,23-24H,10-11H2,(H,21,22) | |||
| StdInChIKey = GWOFUCIGLDBNKM-UHFFFAOYSA-N | |||
}} | |||
__NOTOC__ | |||
{{CMG}} | |||
==Overview== | ==Overview== | ||
'''Glafenine''' is a [[non-steroidal anti-inflammatory drug]] (NSAID). Use of glafenine is limited due to the risk of [[anaphylaxis]] and [[acute renal failure]].<ref>{{Cite journal | doi = 10.1016/0140-6736(92)91670-4 | title = Withdrawal of glafenine | year = 1992 | journal = The Lancet | volume = 339 | issue = 8789 | pages = 357}}</ref><ref>{{Cite journal | pmid = 2873910 | year = 1986 | last1 = Kleinknecht | first1 = D | last2 = Landais | first2 = P | last3 = Goldfarb | first3 = B | title = Analgesic and non-steroidal anti-inflammatory drug-associated acute renal failure: A prospective collaborative study | volume = 25 | issue = 6 | pages = 275–81 | journal = Clinical nephrology}}</ref> | |||
==Category== | ==Category== | ||
Non-Steroidal Anti-Inflammatory Drug | |||
==References== | |||
{{Reflist|2}} | |||
{{analgesics}} | |||
[[Category:Needs content]] | |||
[[Category: | [[Category:Analgesics]] | ||
[[Category:Quinolines]] | |||
[[Category:Drugs]] | [[Category:Drugs]] |
Latest revision as of 19:53, 4 February 2014
![]() | |
Clinical data | |
---|---|
ATC code | |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
ChemSpider | |
ChEBI | |
E number | {{#property:P628}} |
ECHA InfoCard | {{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value). |
Chemical and physical data | |
Formula | C19H17ClN2O4 |
Molar mass | 372.802 g/mol |
3D model (JSmol) | |
| |
|
Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]
Overview
Glafenine is a non-steroidal anti-inflammatory drug (NSAID). Use of glafenine is limited due to the risk of anaphylaxis and acute renal failure.[1][2]
Category
Non-Steroidal Anti-Inflammatory Drug
References
- ↑ "Withdrawal of glafenine". The Lancet. 339 (8789): 357. 1992. doi:10.1016/0140-6736(92)91670-4.
- ↑ Kleinknecht, D; Landais, P; Goldfarb, B (1986). "Analgesic and non-steroidal anti-inflammatory drug-associated acute renal failure: A prospective collaborative study". Clinical nephrology. 25 (6): 275–81. PMID 2873910.
Categories:
- Pages with script errors
- E number from Wikidata
- ECHA InfoCard ID from Wikidata
- Chemical articles with unknown parameter in Infobox drug
- Infobox drug articles with non-default infobox title
- Chemical pages without DrugBank identifier
- Articles without KEGG source
- Articles without UNII source
- Drugs with no legal status
- Articles containing unverified chemical infoboxes
- Needs content
- Analgesics
- Quinolines
- Drugs