Arginine (data page)

Jump to: navigation, search


The complete data for Arginine
350px
File:Hight setter 449px.gifSkeletal structure of L-arginine 3D structure of L-arginine
General information
400px
Chemical formula: C6H14N4O2 
Molar mass: 174.2 g·mol-1
Systematic name:
2-amino-5-(diaminomethylidene amino)pentanoic acid
Abbreviations: R, Arg
Synonyms:
2-amino-5-guanidinopentanoic acid
2-amino-5-guanidinovaleric acid
AIDS{-}121865
AIDS{-}159840
Argamine
Arginin
Argivene
CHEBI:29016
CHEMBANK2983
Detoxargin
Harg
Levargin
Minophagen A
R-Gene
Database data
SMILES: NC(=N)NCCCC(N)C(=O)O
InChI=1/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/f/h11H,8-9H2
 ATC: N/A CAS:
157-06-2 (D), 74-79-3 (L) 
 DrugBank: N/A EINECS:
205-866-5 (D) [1], 200-811-1 (L) [2]
 PubChem:
71070 (D) [3], 6322 (L) [4]
Physical properties
Structure
Crystal data
Spectral data
UV-Vis
IR
NMR
MS
Phase behavior
Solid properties
ρsolid: 1.1 g.cm-3
Tm: 244 °C
Liquid properties
Gas properties
Hazard properties
MSDS N/AMain hazards:
- N/A
NFPA 704
NFPA 704.svg
Flash point
- N/A
R/S statement
R: N/A
S: N/A
RTECS number:
N/A
Chemical properties
XLogP: -3.878pI: 10.76pKa: 2.03; 9.00; 12.10Tautomers: 2Hydrogen bond: donor - 4;   acceptor - 6;
Pharmacological properties
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa)


References

  1. a  EINECS number 205-866-5 ((-)-D-arginine hydrate)
  2. a  EINECS number 200-811-1 (for L-arginine)
  3. a  CID 71070 from PubChem (D-arginine)
  4. a  CID 6322 from PubChem (L-arginine)


v  d  e
Major families of biochemicals
Peptides | Amino acids | Nucleic acids | Carbohydrates | Nucleotide sugars | Lipids | Terpenes | Carotenoids | Tetrapyrroles | Enzyme cofactors | Steroids | Flavonoids | Alkaloids | Polyketides | Glycosides
Analogues of nucleic acids:The 20 Common Amino Acids ("dp" = data page)Analogues of nucleic acids:
Alanine (dp) | Arginine (dp) | Asparagine (dp) | Aspartic acid (dp) | Cysteine (dp) | Glutamic acid (dp) | Glutamine (dp) | Glycine (dp) | Histidine (dp) | Isoleucine (dp) | Leucine (dp) | Lysine (dp) | Methionine (dp) | Phenylalanine (dp) | Proline (dp) | Serine (dp) | Threonine (dp) | Tryptophan (dp) | Tyrosine (dp) | Valine (dp)

ar:أرجنين (صفحة بيانات)


Linked-in.jpg