Phenylalanine (data page)

Jump to: navigation, search
The complete data for Phenylalanine
350px
File:Hight setter 449px.gifSkeletal structure of L-phenylalanine 3D structure of L-phenylalanine
General information
400px
Chemical formula: C9H11NO2 
Molar mass: 165.19 g·mol-1
Systematic name:
2-Amino-3-phenyl-propanoic acid
Abbreviations: F, Phe
Synonyms:
alpha-Amino-beta-phenylpropionic acid
(2R)-2-amino-3- phenylpropanoic acid
(2S)-2-amino-3-phenylpropanoic acid
Database data
SMILES: C1=CC=C(C=C1)CC(C(=O)O)N
InChI=1/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1/f/h11H
 ATC: N/A CAS: 673-06-3 (D), 63-91-2(L), 150-30-1 (DL) DrugBank: N/A EINECS:
211-603-5 [1], 200-568-1 (D), 205-756-7 (L)
 PubChem:
994 [2], 71567 (D) [3] 6140 (L) [4]
Physical properties
Structure
Crystal data
Spectral data
UV-Vis
IR
NMR
MS
Phase behavior
Solid properties
ρsolid: 1.29 g.cm-3
Tm: 283 °C
Liquid properties
Gas properties
Hazard properties
MSDS N/AMain hazards:
- N/A
NFPA 704
NFPA 704.svg
Flash point
- N/A
R/S statement
R: N/A
S: N/A
RTECS number:
N/A
Chemical properties
XLogP: -1.496pI: 5.5pKa: 2.20, 9.09Tautomers: ?Hydrogen bond: donor - 2;   acceptor - 3;
Pharmacological properties
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa)


References

  1. a  EINECS number 200-568-1 (phenylalanine)
  2. a  CID 994 from PubChem (phenylalanine)
  3. a  CID 71567 from PubChem (D-phenylalanine)
  4. a  CID 6140 from PubChem (L-phenylalanine)


v  d  e
Major families of biochemicals
Peptides | Amino acids | Nucleic acids | Carbohydrates | Nucleotide sugars | Lipids | Terpenes | Carotenoids | Tetrapyrroles | Enzyme cofactors | Steroids | Flavonoids | Alkaloids | Polyketides | Glycosides
Analogues of nucleic acids:The 20 Common Amino Acids ("dp" = data page)Analogues of nucleic acids:
Alanine (dp) | Arginine (dp) | Asparagine (dp) | Aspartic acid (dp) | Cysteine (dp) | Glutamic acid (dp) | Glutamine (dp) | Glycine (dp) | Histidine (dp) | Isoleucine (dp) | Leucine (dp) | Lysine (dp) | Methionine (dp) | Phenylalanine (dp) | Proline (dp) | Serine (dp) | Threonine (dp) | Tryptophan (dp) | Tyrosine (dp) | Valine (dp)

ar:فينيلألانين (صفحة بيانات)


Linked-in.jpg