Sulfamethizole: Difference between revisions
Jump to navigation
Jump to search
m (Robot: Automated text replacement (-{{SIB}} +, -{{EH}} +, -{{EJ}} +, -{{Editor Help}} +, -{{Editor Join}} +)) |
No edit summary |
||
Line 1: | Line 1: | ||
{{ | |||
{{Drugbox | |||
| verifiedrevid = 470473060 | |||
| IUPAC_name = 4-amino-''N''-(5-methyl-1,3,4-thiadiazol-2-yl)- benzenesulfonamide | | IUPAC_name = 4-amino-''N''-(5-methyl-1,3,4-thiadiazol-2-yl)- benzenesulfonamide | ||
| image = Sulfamethizole.svg | | image = Sulfamethizole.svg | ||
| width = 250 | | width = 250 | ||
| | <!--Clinical data--> | ||
| | | tradename = | ||
| Drugs.com = {{drugs.com|CONS|sulfamethizole}} | |||
| | | MedlinePlus = a682231 | ||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | ||
| pregnancy_US = <!-- A / B / C / D / X --> | | pregnancy_US = <!-- A / B / C / D / X --> | ||
| pregnancy_category = | | pregnancy_category = | ||
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 --> | | legal_AU = <!-- Unscheduled / S2 / S4 / S8 --> | ||
| legal_UK = <!-- GSL / P / POM / CD --> | | legal_UK = <!-- GSL / P / POM / CD --> | ||
| legal_US = <!-- OTC / Rx-only --> | | legal_US = <!-- OTC / Rx-only --> | ||
| legal_status = | | legal_status = | ||
| routes_of_administration = | | routes_of_administration = | ||
<!--Pharmacokinetic data--> | |||
| bioavailability = | |||
| protein_bound = 98–99% | |||
| metabolism = | |||
| elimination_half-life = 3–8 hours | |||
| excretion = | |||
<!--Identifiers--> | |||
| CASNo_Ref = {{cascite|correct|CAS}} | |||
| CAS_number_Ref = {{cascite|correct|??}} | |||
| CAS_number = 144-82-1 | |||
| ATC_prefix = B05 | |||
| ATC_suffix = CA04 | |||
| ATC_supplemental = {{ATC|D06|BA04}} {{ATC|J01|EB02}} {{ATC|S01|AB01}} {{ATCvet|J01|EQ02}} | |||
| PubChem = 5328 | |||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | |||
| DrugBank = DB00576 | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChemSpiderID = 5137 | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| UNII = 25W8454H16 | |||
| KEGG_Ref = {{keggcite|correct|kegg}} | |||
| KEGG = D00870 | |||
| ChEBI_Ref = {{ebicite|correct|EBI}} | |||
| ChEBI = 9331 | |||
| ChEMBL_Ref = {{ebicite|correct|EBI}} | |||
| ChEMBL = 1191 | |||
<!--Chemical data--> | |||
| C=9 | H=10 | N=4 | O=2 | S=2 | |||
| molecular_weight = 270.333 g/mol | |||
| smiles = O=S(=O)(Nc1nnc(s1)C)c2ccc(N)cc2 | |||
| InChI = 1/C9H10N4O2S2/c1-6-11-12-9(16-6)13-17(14,15)8-4-2-7(10)3-5-8/h2-5H,10H2,1H3,(H,12,13) | |||
| InChIKey = VACCAVUAMIDAGB-UHFFFAOYAZ | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChI = 1S/C9H10N4O2S2/c1-6-11-12-9(16-6)13-17(14,15)8-4-2-7(10)3-5-8/h2-5H,10H2,1H3,(H,12,13) | |||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChIKey = VACCAVUAMIDAGB-UHFFFAOYSA-N | |||
}} | |||
'''Sulfamethizole''' is a [[sulfonamide (medicine)|sulfonamide]] [[antibiotic]]. | |||
==References== | |||
* {{cite journal | author = Ratanajamit C, Skriver M, Nørgaard M, Jepsen P, Schønheyder H, Sørensen H | title = Adverse pregnancy outcome in users of sulfamethizole during pregnancy: a population-based observational study. | journal = J Antimicrob Chemother | volume = 52 | issue = 5 | pages = 837–41 | year = 2003 | pmid = 14519675 | doi = 10.1093/jac/dkg438}} | |||
* {{cite journal | author = Kerrn M, Frimodt-Møller N, Espersen F | title = Effects of Sulfamethizole and Amdinocillin against Escherichia coli Strains (with Various Susceptibilities) in an Ascending Urinary Tract Infection Mouse Model | journal = Antimicrob Agents Chemother | volume = 47 | issue = 3 | pages = 1002–9 | year = 2003 | pmid = 12604534 | doi = 10.1128/AAC.47.3.1002-1009.2003 | pmc = 149286}} | |||
* {{cite journal | author = Watanabe H, Hastings J | title = Inhibition of bioluminescence in Photobacterium phosphoreum by sulfamethizole and its stimulation by thymine | journal = Biochim Biophys Acta | volume = 1017 | issue = 3 | pages = 229–34 | year = 1990 | pmid = 2372557 | doi = 10.1016/0005-2728(90)90189-B}} | |||
{{Antibiotics and chemotherapeutics for dermatological use}} | {{Antibiotics and chemotherapeutics for dermatological use}} | ||
{{SulfonamideAntiBiotics}} | {{SulfonamideAntiBiotics}} | ||
[[Category:Sulfonamide antibiotics]] | |||
[[Category:Thiadiazoles]] | |||
{{antibiotic-stub}} | |||
{{blood-drug-stub}} | |||
{{dermatologic-drug-stub}} | |||
{{ | |||
{{ |
Revision as of 14:43, 13 April 2015
File:Sulfamethizole.svg | |
Clinical data | |
---|---|
AHFS/Drugs.com | Micromedex Detailed Consumer Information |
MedlinePlus | a682231 |
ATC code | |
Pharmacokinetic data | |
Protein binding | 98–99% |
Elimination half-life | 3–8 hours |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
DrugBank | |
ChemSpider | |
UNII | |
KEGG | |
ChEBI | |
ChEMBL | |
E number | {{#property:P628}} |
ECHA InfoCard | {{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value). |
Chemical and physical data | |
Formula | C9H10N4O2S2 |
Molar mass | 270.333 g/mol |
3D model (JSmol) | |
| |
| |
(verify) |
Sulfamethizole is a sulfonamide antibiotic.
References
- Ratanajamit C, Skriver M, Nørgaard M, Jepsen P, Schønheyder H, Sørensen H (2003). "Adverse pregnancy outcome in users of sulfamethizole during pregnancy: a population-based observational study". J Antimicrob Chemother. 52 (5): 837–41. doi:10.1093/jac/dkg438. PMID 14519675.
- Kerrn M, Frimodt-Møller N, Espersen F (2003). "Effects of Sulfamethizole and Amdinocillin against Escherichia coli Strains (with Various Susceptibilities) in an Ascending Urinary Tract Infection Mouse Model". Antimicrob Agents Chemother. 47 (3): 1002–9. doi:10.1128/AAC.47.3.1002-1009.2003. PMC 149286. PMID 12604534.
- Watanabe H, Hastings J (1990). "Inhibition of bioluminescence in Photobacterium phosphoreum by sulfamethizole and its stimulation by thymine". Biochim Biophys Acta. 1017 (3): 229–34. doi:10.1016/0005-2728(90)90189-B. PMID 2372557.
Template:SulfonamideAntiBiotics
Template:Antibiotic-stub
Template:Blood-drug-stub
Template:Dermatologic-drug-stub
Categories:
- Pages with script errors
- Pages with broken file links
- Template:drugs.com link with non-standard subpage
- E number from Wikidata
- ECHA InfoCard ID from Wikidata
- Chemical articles with unknown parameter in Infobox drug
- Drugs with no legal status
- CS1 maint: Multiple names: authors list
- Sulfonamide antibiotics
- Thiadiazoles