Sulfamethizole: Difference between revisions

Jump to navigation Jump to search
VisualWikitext
m (Robot: Automated text replacement (-{{SIB}} +, -{{EH}} +, -{{EJ}} +, -{{Editor Help}} +, -{{Editor Join}} +))
No edit summary
Line 1: Line 1:
{{drugbox
 
{{Drugbox
| verifiedrevid = 470473060
| IUPAC_name = 4-amino-''N''-(5-methyl-1,3,4-thiadiazol-2-yl)- benzenesulfonamide
| IUPAC_name = 4-amino-''N''-(5-methyl-1,3,4-thiadiazol-2-yl)- benzenesulfonamide
| image = Sulfamethizole.svg
| image = Sulfamethizole.svg
| width = 250
| width = 250
| CAS_number = 144-82-1
 
| ATC_prefix = B05
<!--Clinical data-->
| ATC_suffix = CA04
| tradename =
| ATC_supplemental = {{ATC|D06|BA04}}, {{ATC|J01|EB02}}, {{ATC|S01|AB01}}
| Drugs.com = {{drugs.com|CONS|sulfamethizole}}
| PubChem = 5328
| MedlinePlus = a682231
| DrugBank = APRD00684
| C = 9 | H = 10 | N = 4 | O = 2 | S = 2
| molecular_weight = 270.333 g/mol
| bioavailability =
| protein_bound = 98–99%
| metabolism =
| elimination_half-life = 3–8 hours
| excretion =  
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =  
| pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 -->
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 -->
| legal_UK = <!-- GSL / P / POM / CD -->
| legal_UK = <!-- GSL / P / POM / CD -->
| legal_US = <!-- OTC / Rx-only -->
| legal_US = <!-- OTC / Rx-only -->
| legal_status =  
| legal_status =
| routes_of_administration =  
| routes_of_administration =
}}
{{SI}}


<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 98–99%
| metabolism = 
| elimination_half-life = 3–8 hours
| excretion = 


'''Sulfamethizole''' is a [[sulfonamide]] [[antibiotic]].
<!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 144-82-1
| ATC_prefix = B05
| ATC_suffix = CA04
| ATC_supplemental =  {{ATC|D06|BA04}} {{ATC|J01|EB02}} {{ATC|S01|AB01}} {{ATCvet|J01|EQ02}}
| PubChem = 5328
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00576
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5137
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 25W8454H16
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00870
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 9331
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1191


==External links==
<!--Chemical data-->
* {{cite journal | author = Ratanajamit C, Skriver M, Nørgaard M, Jepsen P, Schønheyder H, Sørensen H | title = Adverse pregnancy outcome in users of sulfamethizole during pregnancy: a population-based observational study. | journal = J Antimicrob Chemother | volume = 52 | issue = 5 | pages = 837-41 | year = 2003 | id = PMID 14519675}}
| C=9 | H=10 | N=4 | O=2 | S=2
* {{cite journal | author = Kerrn M, Frimodt-Møller N, Espersen F | title = Effects of sulfamethizole and amdinocillin against Escherichia coli strains (with various susceptibilities) in an ascending urinary tract infection mouse model. | journal = Antimicrob Agents Chemother | volume = 47 | issue = 3 | pages = 1002-9 | year = 2003 | id = PMID 12604534}}
| molecular_weight = 270.333 g/mol
* {{cite journal | author = Watanabe H, Hastings J | title = Inhibition of bioluminescence in Photobacterium phosphoreum by sulfamethizole and its stimulation by thymine. | journal = Biochim Biophys Acta | volume = 1017 | issue = 3 | pages = 229-34 | year = 1990 | id = PMID 2372557}}
| smiles = O=S(=O)(Nc1nnc(s1)C)c2ccc(N)cc2
| InChI = 1/C9H10N4O2S2/c1-6-11-12-9(16-6)13-17(14,15)8-4-2-7(10)3-5-8/h2-5H,10H2,1H3,(H,12,13)
| InChIKey = VACCAVUAMIDAGB-UHFFFAOYAZ
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C9H10N4O2S2/c1-6-11-12-9(16-6)13-17(14,15)8-4-2-7(10)3-5-8/h2-5H,10H2,1H3,(H,12,13)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = VACCAVUAMIDAGB-UHFFFAOYSA-N
}}
'''Sulfamethizole''' is a [[sulfonamide (medicine)|sulfonamide]] [[antibiotic]].


==References==
* {{cite journal | author = Ratanajamit C, Skriver M, Nørgaard M, Jepsen P, Schønheyder H, Sørensen H | title = Adverse pregnancy outcome in users of sulfamethizole during pregnancy: a population-based observational study. | journal = J Antimicrob Chemother | volume = 52 | issue = 5 | pages = 837–41 | year = 2003 | pmid = 14519675 | doi = 10.1093/jac/dkg438}}
* {{cite journal | author = Kerrn M, Frimodt-Møller N, Espersen F | title = Effects of Sulfamethizole and Amdinocillin against Escherichia coli Strains (with Various Susceptibilities) in an Ascending Urinary Tract Infection Mouse Model | journal = Antimicrob Agents Chemother | volume = 47 | issue = 3 | pages = 1002–9 | year = 2003 | pmid = 12604534 | doi = 10.1128/AAC.47.3.1002-1009.2003 | pmc = 149286}}
* {{cite journal | author = Watanabe H, Hastings J | title = Inhibition of bioluminescence in Photobacterium phosphoreum by sulfamethizole and its stimulation by thymine | journal = Biochim Biophys Acta | volume = 1017 | issue = 3 | pages = 229–34 | year = 1990 | pmid = 2372557 | doi = 10.1016/0005-2728(90)90189-B}}


{{Antibiotics and chemotherapeutics for dermatological use}}
{{Antibiotics and chemotherapeutics for dermatological use}}
{{SulfonamideAntiBiotics}}
{{SulfonamideAntiBiotics}}


[[Category:Sulfonamide antibiotics]]
[[Category:Thiadiazoles]]




 
{{antibiotic-stub}}
[[th:ซัลฟาเมไทโซล]]
{{blood-drug-stub}}
[[Category:Sulfonamide antibiotics]]
{{dermatologic-drug-stub}}
{{WH}}
{{WS}}

Revision as of 14:43, 13 April 2015

Sulfamethizole
File:Sulfamethizole.svg
Clinical data
AHFS/Drugs.comMicromedex Detailed Consumer Information
MedlinePlusa682231
ATC code
Pharmacokinetic data
Protein binding98–99%
Elimination half-life3–8 hours
Identifiers
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
ChEBI
ChEMBL
E number{{#property:P628}}
ECHA InfoCard{{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value).
Chemical and physical data
FormulaC9H10N4O2S2
Molar mass270.333 g/mol
3D model (JSmol)
  (verify)

Sulfamethizole is a sulfonamide antibiotic.

References

  • Ratanajamit C, Skriver M, Nørgaard M, Jepsen P, Schønheyder H, Sørensen H (2003). "Adverse pregnancy outcome in users of sulfamethizole during pregnancy: a population-based observational study". J Antimicrob Chemother. 52 (5): 837–41. doi:10.1093/jac/dkg438. PMID 14519675.
  • Kerrn M, Frimodt-Møller N, Espersen F (2003). "Effects of Sulfamethizole and Amdinocillin against Escherichia coli Strains (with Various Susceptibilities) in an Ascending Urinary Tract Infection Mouse Model". Antimicrob Agents Chemother. 47 (3): 1002–9. doi:10.1128/AAC.47.3.1002-1009.2003. PMC 149286. PMID 12604534.
  • Watanabe H, Hastings J (1990). "Inhibition of bioluminescence in Photobacterium phosphoreum by sulfamethizole and its stimulation by thymine". Biochim Biophys Acta. 1017 (3): 229–34. doi:10.1016/0005-2728(90)90189-B. PMID 2372557.

Template:SulfonamideAntiBiotics


Template:Antibiotic-stub Template:Blood-drug-stub Template:Dermatologic-drug-stub

Retrieved from "https://www.wikidoc.org/index.php?title=Sulfamethizole&oldid=1086574"