Terizidone: Difference between revisions
No edit summary |
No edit summary |
||
Line 1: | Line 1: | ||
{{ | {{Drugbox | ||
| IUPAC_name | | Verifiedfields = changed | ||
| image | | verifiedrevid = 470602455 | ||
| | | IUPAC_name = 4,4'-{1,4-phenylenebis[(''E'')methylylidenenitrilo]}diisoxazolidin-3-one | ||
| image = Terizidone.png | |||
| image2 = Terizidone_ball-and-stick.png | |||
| | |||
| | <!--Clinical data--> | ||
| tradename = | |||
| | | Drugs.com = {{drugs.com|international|terizidone}} | ||
| | | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | ||
| pregnancy_US = <!-- A / B / C / D / X --> | |||
| pregnancy_category = C | |||
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | |||
| pregnancy_AU | | legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> | ||
| pregnancy_US | | legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> | ||
| pregnancy_category= | | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | ||
| legal_AU | | legal_status = | ||
| legal_CA | | routes_of_administration = | ||
| legal_UK | |||
| legal_US | <!--Pharmacokinetic data--> | ||
| legal_status | | bioavailability = | ||
| routes_of_administration = | | protein_bound = | ||
| metabolism = | |||
| elimination_half-life = | |||
| excretion = | |||
<!--Identifiers--> | |||
| CAS_number_Ref = {{cascite|changed|??}} | |||
| CAS_number = 25683-71-0 | |||
| ATC_prefix = J04 | |||
| ATC_suffix = AK03 | |||
| PubChem = 65720 | |||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | |||
| DrugBank = | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChemSpiderID = 59144 | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| UNII = 1199LEX5N8 | |||
| KEGG_Ref = {{keggcite|correct|kegg}} | |||
| KEGG = D07247 | |||
<!--Chemical data--> | |||
| C=14 | H=14 | N=4 | O=4 | |||
| molecular_weight = 302.286 g/mol | |||
| smiles = O=C3NOCC3/N=C/c2ccc(/C=N/C1C(=O)NOC1)cc2 | |||
| InChI = 1/C14H14N4O4/c19-13-11(7-21-17-13)15-5-9-1-2-10(4-3-9)6-16-12-8-22-18-14(12)20/h1-6,11-12H,7-8H2,(H,17,19)(H,18,20)/b15-5+,16-6+ | |||
| InChIKey = ODKYYBOHSVLGNU-IAGONARPBB | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChI = 1S/C14H14N4O4/c19-13-11(7-21-17-13)15-5-9-1-2-10(4-3-9)6-16-12-8-22-18-14(12)20/h1-6,11-12H,7-8H2,(H,17,19)(H,18,20)/b15-5+,16-6+ | |||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChIKey = ODKYYBOHSVLGNU-IAGONARPSA-N | |||
| synonyms = <small>4-[({4-[''N''-(3-oxo-1,2-oxazolidin-4-yl)carboximidoyl]phenyl}methylidene)amino]-1,2-oxazolidin-3-one</small> | |||
}} | }} | ||
__NOTOC__ | __NOTOC__ | ||
{{SI}} | {{SI}} | ||
{{CMG}} | {{CMG}} |
Revision as of 15:37, 8 April 2015
{{Drugbox | Verifiedfields = changed | verifiedrevid = 470602455 | IUPAC_name = 4,4'-{1,4-phenylenebis[(E)methylylidenenitrilo]}diisoxazolidin-3-one | image = Terizidone.png | image2 = Terizidone_ball-and-stick.png
| tradename =
| Drugs.com = International Drug Names
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category = C
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number_Ref =
| CAS_number = 25683-71-0
| ATC_prefix = J04
| ATC_suffix = AK03
| PubChem = 65720
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref =
| ChemSpiderID = 59144
| UNII_Ref =
| UNII = 1199LEX5N8
| KEGG_Ref =
| KEGG = D07247
| C=14 | H=14 | N=4 | O=4
| molecular_weight = 302.286 g/mol
| smiles = O=C3NOCC3/N=C/c2ccc(/C=N/C1C(=O)NOC1)cc2
| InChI = 1/C14H14N4O4/c19-13-11(7-21-17-13)15-5-9-1-2-10(4-3-9)6-16-12-8-22-18-14(12)20/h1-6,11-12H,7-8H2,(H,17,19)(H,18,20)/b15-5+,16-6+
| InChIKey = ODKYYBOHSVLGNU-IAGONARPBB
| StdInChI_Ref =
| StdInChI = 1S/C14H14N4O4/c19-13-11(7-21-17-13)15-5-9-1-2-10(4-3-9)6-16-12-8-22-18-14(12)20/h1-6,11-12H,7-8H2,(H,17,19)(H,18,20)/b15-5+,16-6+
| StdInChIKey_Ref =
| StdInChIKey = ODKYYBOHSVLGNU-IAGONARPSA-N
| synonyms = 4-[({4-[N-(3-oxo-1,2-oxazolidin-4-yl)carboximidoyl]phenyl}methylidene)amino]-1,2-oxazolidin-3-one
}}
WikiDoc Resources for Terizidone |
Articles |
---|
Most recent articles on Terizidone |
Media |
Evidence Based Medicine |
Clinical Trials |
Ongoing Trials on Terizidone at Clinical Trials.gov Clinical Trials on Terizidone at Google
|
Guidelines / Policies / Govt |
US National Guidelines Clearinghouse on Terizidone
|
Books |
News |
Commentary |
Definitions |
Patient Resources / Community |
Patient resources on Terizidone Discussion groups on Terizidone Patient Handouts on Terizidone Directions to Hospitals Treating Terizidone Risk calculators and risk factors for Terizidone
|
Healthcare Provider Resources |
Causes & Risk Factors for Terizidone |
Continuing Medical Education (CME) |
International |
|
Business |
Experimental / Informatics |
Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]
Overview
Terizidone is a drug used in the treatment of tuberculosis.
References