Ioglicic acid
{{Drugbox | IUPAC_name = 3-acetamido-2,4,6-triiodo-5-{[(methylcarbamoyl)methyl]carbamoyl}benzoic acid | image =Ioglicic acid.png
| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number = 49755-67-1
| ATC_prefix = V08
| ATC_suffix = AA06
| PubChem = 65437
| DrugBank =
| ChemSpiderID = 58900
| UNII_Ref = 
| UNII = 3LGR5S8101
| KEGG = D04574
| ChEMBL = 1201291
| C=13 | H=12 | I=3 | N=3 | O=5 | molecular_weight = 670.96 g/mol | smiles = Ic1c(c(I)c(c(I)c1NC(=O)C)C(=O)O)C(=O)NCC(=O)NC }}
|
WikiDoc Resources for Ioglicic acid |
|
Articles |
|---|
|
Most recent articles on Ioglicic acid Most cited articles on Ioglicic acid |
|
Media |
|
Powerpoint slides on Ioglicic acid |
|
Evidence Based Medicine |
|
Clinical Trials |
|
Ongoing Trials on Ioglicic acid at Clinical Trials.gov Trial results on Ioglicic acid Clinical Trials on Ioglicic acid at Google
|
|
Guidelines / Policies / Govt |
|
US National Guidelines Clearinghouse on Ioglicic acid NICE Guidance on Ioglicic acid
|
|
Books |
|
News |
|
Commentary |
|
Definitions |
|
Patient Resources / Community |
|
Patient resources on Ioglicic acid Discussion groups on Ioglicic acid Patient Handouts on Ioglicic acid Directions to Hospitals Treating Ioglicic acid Risk calculators and risk factors for Ioglicic acid
|
|
Healthcare Provider Resources |
|
Causes & Risk Factors for Ioglicic acid |
|
Continuing Medical Education (CME) |
|
International |
|
|
|
Business |
|
Experimental / Informatics |
Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]
Overview
Ioglicic acid is a molecule used as a contrast medium.