Indanylaminopropane

Jump to: navigation, search


Indanylaminopropane
Chemical name1-(2,3-dihydro-1H-inden-5-yl)propan-2-amine or
5-(2-aminopropyl)indane
Chemical formulaC12H17N
Molecular mass175.27 g/mol
Melting pointUnknown
CAS number
SMILESCC(CC1=CC2=C(CCC2)C=C1)N

Indanylamphetamine, or 1-(5-Indanyl)-2-aminopropane (IAP), is chemical relative similar to MDMA. The reported potency is between that MDMA and MBDB. The difference between IAP and MDA is the indanyl- core rather than methylenedioxy-; the two oxygens in methylenedioxy- are instead changed to two methylene molecules. IAP is not considered an analogue of MDMA, because the core is of a different structure.

External Links

Erowid IAP vault


Template:Amine-stub



Linked-in.jpg