Stepronin: Difference between revisions
No edit summary |
(No difference)
|
Revision as of 14:09, 15 April 2015
{{Drugbox | verifiedrevid = 447817179 | IUPAC_name = N-{2-[(2-thienylcarbonyl)thio]propanoyl}glycine | image = Stepronin.svg
| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CASNo_Ref = | CAS_number = 72324-18-6 | ATC_prefix = R05 | ATC_suffix = CB11 | PubChem = 54120 | DrugBank_Ref = | DrugBank = DB01423 | ChemSpiderID_Ref = | ChemSpiderID = 48889 | UNII_Ref = | UNII = 0NOY894QRB | KEGG_Ref = | KEGG = D07381
| C=10 | H=11 | N=1 | O=4 | S=2 | molecular_weight = 273.331 g/mol | smiles = CC(C(=O)NCC(=O)O)SC(=O)C1=CC=CS1 | StdInChI_Ref = | StdInChI = 1S/C10H11NO4S2/c1-6(9(14)11-5-8(12)13)17-10(15)7-3-2-4-16-7/h2-4,6H,5H2,1H3,(H,11,14)(H,12,13) | StdInChIKey_Ref = | StdInChIKey = JNYSEDHQJCOWQU-UHFFFAOYSA-N }} Stepronin is a mucolytic[1] and expectorant.[2]
References
- ↑ PMID 3843171 (PMID 3843171)
Citation will be completed automatically in a few minutes. Jump the queue or expand by hand - ↑ PMID 8177972 (PMID 8177972)
Citation will be completed automatically in a few minutes. Jump the queue or expand by hand