Oxolamine: Difference between revisions

Jump to navigation Jump to search
VisualWikitext
m (Protected "Oxolamine": Protecting pages from unwanted edits ([edit=sysop] (indefinite) [move=sysop] (indefinite)))
 
No edit summary
Line 1: Line 1:
{{drugbox
{{Drugbox
| IUPAC_name       = N,N-diethyl-2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine
| Verifiedfields = changed
| image             = Oxolamine.png
| verifiedrevid = 447812881
| CAS_number        = 959-14-8
| IUPAC_name = N,N-diethyl-2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine
| ATC_prefix        = R05
| image = Oxolamine.png
| ATC_suffix        = DB07
 
| PubChem          = 13738
<!--Clinical data-->
| DrugBank          =
| tradename =
| C=14|H=19|N=3|O=1
| Drugs.com = {{drugs.com|international|oxolamine}}
| molecular_weight  = 245.32 g/mol
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| bioavailability  =
| pregnancy_US = <!-- A / B            / C / D / X -->
| protein_bound    =
| pregnancy_category =   
| metabolism        =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| elimination_half-life =
| legal_CA = <!--            / Schedule I, II, III, IV, V, VI, VII, VIII -->
| excretion        =
| legal_UK = <!-- GSL        / P      / POM / CD / Class A, B, C -->
| pregnancy_AU     = <!-- A / B1 / B2 / B3 / C / D / X -->
| legal_US = <!-- OTC                  / Rx-only  / Schedule I, II, III, IV, V -->
| pregnancy_US     = <!-- A / B            / C / D / X -->
| legal_status =
| pregnancy_category=   
| routes_of_administration =
| legal_AU         = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
 
| legal_CA         = <!--            / Schedule I, II, III, IV, V, VI, VII, VIII -->
<!--Pharmacokinetic data-->
| legal_UK         = <!-- GSL        / P      / POM / CD / Class A, B, C -->
| bioavailability = 
| legal_US         = <!-- OTC                  / Rx-only  / Schedule I, II, III, IV, V -->
| protein_bound = 
| legal_status     =  
| metabolism = 
| routes_of_administration =  
| elimination_half-life = 
| excretion = 
 
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 959-14-8
| ATC_prefix = R05
| ATC_suffix = DB07
| PubChem = 13738
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = 
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 13143
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 90BEA145GY
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07387
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1620875
 
<!--Chemical data-->
| C=14 | H=19 | N=3 | O=1
| molecular_weight = 245.32 g/mol
| smiles = n1c(onc1c2ccccc2)CCN(CC)CC
| InChI = 1/C14H19N3O/c1-3-17(4-2)11-10-13-15-14(16-18-13)12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3
| InChIKey = IDCHQQSVJAAUQQ-UHFFFAOYAF
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C14H19N3O/c1-3-17(4-2)11-10-13-15-14(16-18-13)12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = IDCHQQSVJAAUQQ-UHFFFAOYSA-N
}}
}}


'''Oxolamine''' is a [[cough suppressant]].
'''Oxolamine''' is a [[cough suppressant]].


{{pharmacology-stub}}


{{Cough and cold preparations}}
{{Cough and cold preparations}}


[[Category:Antitussives]]
[[Category:Antitussives]]
{{WikiDoc Sources}}
[[Category:Oxadiazoles]]
[[Category:Amines]]

Revision as of 15:29, 10 April 2015

Oxolamine
Clinical data
AHFS/Drugs.comInternational Drug Names
ATC code
Identifiers
CAS Number
PubChem CID
ChemSpider
UNII
KEGG
ChEMBL
E number{{#property:P628}}
ECHA InfoCard{{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value).
Chemical and physical data
FormulaC14H19N3O
Molar mass245.32 g/mol
3D model (JSmol)
 ☒N☑Y (what is this?)  (verify)

Oxolamine is a cough suppressant.


Template:Cough and cold preparations

Retrieved from "https://www.wikidoc.org/index.php?title=Oxolamine&oldid=1085961"