Oxolamine: Difference between revisions
Jump to navigation
Jump to search
m (Protected "Oxolamine": Protecting pages from unwanted edits ([edit=sysop] (indefinite) [move=sysop] (indefinite))) |
No edit summary |
||
Line 1: | Line 1: | ||
{{ | {{Drugbox | ||
| IUPAC_name | | Verifiedfields = changed | ||
| image | | verifiedrevid = 447812881 | ||
| IUPAC_name = N,N-diethyl-2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine | |||
| | | image = Oxolamine.png | ||
| | |||
<!--Clinical data--> | |||
| tradename = | |||
| Drugs.com = {{drugs.com|international|oxolamine}} | |||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | |||
| pregnancy_US = <!-- A / B / C / D / X --> | |||
| pregnancy_category = | |||
| | | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | ||
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> | |||
| | | legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> | ||
| pregnancy_AU | | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | ||
| pregnancy_US | | legal_status = | ||
| pregnancy_category= | | routes_of_administration = | ||
| legal_AU | |||
| legal_CA | <!--Pharmacokinetic data--> | ||
| legal_UK | | bioavailability = | ||
| legal_US | | protein_bound = | ||
| legal_status | | metabolism = | ||
| routes_of_administration = | | elimination_half-life = | ||
| excretion = | |||
<!--Identifiers--> | |||
| CAS_number_Ref = {{cascite|correct|??}} | |||
| CAS_number = 959-14-8 | |||
| ATC_prefix = R05 | |||
| ATC_suffix = DB07 | |||
| PubChem = 13738 | |||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | |||
| DrugBank = | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChemSpiderID = 13143 | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| UNII = 90BEA145GY | |||
| KEGG_Ref = {{keggcite|correct|kegg}} | |||
| KEGG = D07387 | |||
| ChEMBL_Ref = {{ebicite|changed|EBI}} | |||
| ChEMBL = 1620875 | |||
<!--Chemical data--> | |||
| C=14 | H=19 | N=3 | O=1 | |||
| molecular_weight = 245.32 g/mol | |||
| smiles = n1c(onc1c2ccccc2)CCN(CC)CC | |||
| InChI = 1/C14H19N3O/c1-3-17(4-2)11-10-13-15-14(16-18-13)12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3 | |||
| InChIKey = IDCHQQSVJAAUQQ-UHFFFAOYAF | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChI = 1S/C14H19N3O/c1-3-17(4-2)11-10-13-15-14(16-18-13)12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3 | |||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChIKey = IDCHQQSVJAAUQQ-UHFFFAOYSA-N | |||
}} | }} | ||
'''Oxolamine''' is a [[cough suppressant]]. | '''Oxolamine''' is a [[cough suppressant]]. | ||
{{Cough and cold preparations}} | {{Cough and cold preparations}} | ||
[[Category:Antitussives]] | [[Category:Antitussives]] | ||
[[Category:Oxadiazoles]] | |||
[[Category:Amines]] |
Revision as of 15:29, 10 April 2015
Clinical data | |
---|---|
AHFS/Drugs.com | International Drug Names |
ATC code | |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
ChemSpider | |
UNII | |
KEGG | |
ChEMBL | |
E number | {{#property:P628}} |
ECHA InfoCard | {{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value). |
Chemical and physical data | |
Formula | C14H19N3O |
Molar mass | 245.32 g/mol |
3D model (JSmol) | |
| |
| |
(what is this?) (verify) |
Oxolamine is a cough suppressant.
Categories:
- Pages with script errors
- Template:drugs.com link with non-standard subpage
- Articles with changed EBI identifier
- E number from Wikidata
- ECHA InfoCard ID from Wikidata
- Chemical articles with unknown parameter in Infobox drug
- Chemical pages without DrugBank identifier
- Drugs with no legal status
- Drugboxes which contain changes to verified fields
- Antitussives
- Oxadiazoles
- Amines